C9H13FN2O4 — CID 112599755
5-fluoro-6-hydroxy-1-(4-methoxybutyl)pyrimidine-2,4-dione (PubChem CID 112599755) has the molecular formula C9H13FN2O4 and a molecular weight of 232.21 g/mol. Its IUPAC name is 5-fluoro-6-hydroxy-1-(4-methoxybutyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-6-hydroxy-1-(4-methoxybutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599755 |
| Molecular Formula | C9H13FN2O4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 5-fluoro-6-hydroxy-1-(4-methoxybutyl)pyrimidine-2,4-dione |
| SMILES | COCCCCn1c(O)c(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13FN2O4/c1-16-5-3-2-4-12-8(14)6(10)7(13)11-9(12)15/h14H,2-5H2,1H3,(H,11,13,15) |
| InChIKey | JUHBLFCQNPQRIV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|