C11H17FN2O4 — CID 106006125
5-fluoro-6-hydroxy-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione (PubChem CID 106006125) has the molecular formula C11H17FN2O4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-fluoro-6-hydroxy-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-6-hydroxy-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106006125 |
| Molecular Formula | C11H17FN2O4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-fluoro-6-hydroxy-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione |
| SMILES | CC(C)OCCCCn1c(O)c(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17FN2O4/c1-7(2)18-6-4-3-5-14-10(16)8(12)9(15)13-11(14)17/h7,16H,3-6H2,1-2H3,(H,13,15,17) |
| InChIKey | ZGDDNNHFSDLPTL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|