C14H24N2O4 — CID 106006139
6-hydroxy-5-propan-2-yl-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione (PubChem CID 106006139) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-hydroxy-5-propan-2-yl-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-propan-2-yl-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106006139 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 6-hydroxy-5-propan-2-yl-1-(4-propan-2-yloxybutyl)pyrimidine-2,4-dione |
| SMILES | CC(C)OCCCCn1c(O)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H24N2O4/c1-9(2)11-12(17)15-14(19)16(13(11)18)7-5-6-8-20-10(3)4/h9-10,18H,5-8H2,1-4H3,(H,15,17,19) |
| InChIKey | NEQNTXQXRUVILL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|