C10H15FN2O3 — CID 112599740
5-fluoro-6-hydroxy-1-(2-methylpentan-3-yl)pyrimidine-2,4-dione (PubChem CID 112599740) has the molecular formula C10H15FN2O3 and a molecular weight of 230.24 g/mol. Its IUPAC name is 5-fluoro-6-hydroxy-1-(2-methylpentan-3-yl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-6-hydroxy-1-(2-methylpentan-3-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599740 |
| Molecular Formula | C10H15FN2O3 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5-fluoro-6-hydroxy-1-(2-methylpentan-3-yl)pyrimidine-2,4-dione |
| SMILES | CCC(C(C)C)n1c(O)c(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15FN2O3/c1-4-6(5(2)3)13-9(15)7(11)8(14)12-10(13)16/h5-6,15H,4H2,1-3H3,(H,12,14,16) |
| InChIKey | FMGCMUPYZILFIB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |