C11H16FN3O3 — CID 112599825
1-(1-ethylpiperidin-3-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione (PubChem CID 112599825) has the molecular formula C11H16FN3O3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599825 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN1CCCC(n2c(O)c(F)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C11H16FN3O3/c1-2-14-5-3-4-7(6-14)15-10(17)8(12)9(16)13-11(15)18/h7,17H,2-6H2,1H3,(H,13,16,18) |
| InChIKey | FJFZHDCVLDUHOU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |