C18H28N4O3 — CID 135821954
1-cyclohexyl-5-[(E)-C-ethyl-N-piperidin-1-ylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 135821954) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(E)-C-ethyl-N-piperidin-1-ylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-cyclohexyl-5-[(E)-C-ethyl-N-piperidin-1-ylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135821954 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-cyclohexyl-5-[(E)-C-ethyl-N-piperidin-1-ylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC/C(=N\N1CCCCC1)c1c(O)n(C2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H28N4O3/c1-2-14(20-21-11-7-4-8-12-21)15-16(23)19-18(25)22(17(15)24)13-9-5-3-6-10-13/h13,24H,2-12H2,1H3,(H,19,23,25)/b20-14+ |
| InChIKey | CBJVCKNMLGQBPF-XSFVSMFZSA-N |
| XLogP | 2.35 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|