C20H26N4O3 — CID 3345557
5-[N-(azepan-1-yl)-C-ethylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 3345557) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[N-(azepan-1-yl)-C-ethylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[N-(azepan-1-yl)-C-ethylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3345557 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 5-[N-(azepan-1-yl)-C-ethylcarbonimidoyl]-6-hydroxy-1-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | CCC(=NN1CCCCCC1)c1c(O)n(-c2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26N4O3/c1-3-16(22-23-12-6-4-5-7-13-23)17-18(25)21-20(27)24(19(17)26)15-10-8-14(2)9-11-15/h8-11,26H,3-7,12-13H2,1-2H3,(H,21,25,27) |
| InChIKey | HRBMIVFUPFHEMO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|