C21H19N3O5 — CID 3254976
4-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]benzoic acid (PubChem CID 3254976) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]benzoic acid.
| Compound Name | 4-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]benzoic acid |
|---|---|
| PubChem CID | 3254976 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[1-[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]propylideneamino]benzoic acid |
| SMILES | CC/C(=N\c1ccc(C(=O)O)cc1)c1c(O)n(-c2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H19N3O5/c1-3-16(22-14-8-6-13(7-9-14)20(27)28)17-18(25)23-21(29)24(19(17)26)15-10-4-12(2)5-11-15/h4-11,26H,3H2,1-2H3,(H,27,28)(H,23,25,29)/b22-16+ |
| InChIKey | XRNUGFPPYDJXHC-CJLVFECKSA-N |
| XLogP | 2.77 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|