C18H21N3O5 — CID 4887883
4-[1-(1-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)propylideneamino]benzoic acid (PubChem CID 4887883) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[1-(1-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)propylideneamino]benzoic acid.
| Compound Name | 4-[1-(1-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)propylideneamino]benzoic acid |
|---|---|
| PubChem CID | 4887883 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[1-(1-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)propylideneamino]benzoic acid |
| SMILES | CCCCn1c(O)c(/C(CC)=N/c2ccc(C(=O)O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21N3O5/c1-3-5-10-21-16(23)14(15(22)20-18(21)26)13(4-2)19-12-8-6-11(7-9-12)17(24)25/h6-9,23H,3-5,10H2,1-2H3,(H,24,25)(H,20,22,26)/b19-13+ |
| InChIKey | SKUDKGYADUXUJZ-CPNJWEJPSA-N |
| XLogP | 2.27 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|