C17H19N3O5 — CID 3708458
5-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-1-butyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 3708458) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 5-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-1-butyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-1-butyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3708458 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-1-butyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(/C(C)=N/c2ccc3c(c2)OCO3)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H19N3O5/c1-3-4-7-20-16(22)14(15(21)19-17(20)23)10(2)18-11-5-6-12-13(8-11)25-9-24-12/h5-6,8,22H,3-4,7,9H2,1-2H3,(H,19,21,23)/b18-10+ |
| InChIKey | TXNVDGLYWAMBIO-VCHYOVAHSA-N |
| XLogP | 1.91 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|