C19H22N4O5 — CID 9115910
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(1,3-benzodioxol-5-yl)-N-methylprop-2-enamide (PubChem CID 9115910) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(1,3-benzodioxol-5-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(1,3-benzodioxol-5-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9115910 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(1,3-benzodioxol-5-yl)-N-methylprop-2-enamide |
| SMILES | CCCCn1c(N)c(N(C)C(=O)/C=C/c2ccc3c(c2)OCO3)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22N4O5/c1-3-4-9-23-17(20)16(18(25)21-19(23)26)22(2)15(24)8-6-12-5-7-13-14(10-12)28-11-27-13/h5-8,10H,3-4,9,11,20H2,1-2H3,(H,21,25,26)/b8-6+ |
| InChIKey | NNCQTWAFQTWGQH-SOFGYWHQSA-N |
| XLogP | 1.32 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|