C22H23FN4O3S — CID 55504618
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide (PubChem CID 55504618) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55504618 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-methylprop-2-enamide |
| SMILES | CCCCn1c(N)c(N(C)C(=O)/C=C/c2ccc(-c3ccc(F)cc3)s2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H23FN4O3S/c1-3-4-13-27-20(24)19(21(29)25-22(27)30)26(2)18(28)12-10-16-9-11-17(31-16)14-5-7-15(23)8-6-14/h5-12H,3-4,13,24H2,1-2H3,(H,25,29,30)/b12-10+ |
| InChIKey | UUWKRCOLDNQBAY-ZRDIBKRKSA-N |
| XLogP | 3.46 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|