C22H23FN4O4 — CID 26195924
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 26195924) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26195924 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccco2)C(=O)/C=C/c2cccc(F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H23FN4O4/c1-2-3-11-26-20(24)19(21(29)25-22(26)30)27(14-17-8-5-12-31-17)18(28)10-9-15-6-4-7-16(23)13-15/h4-10,12-13H,2-3,11,14,24H2,1H3,(H,25,29,30)/b10-9+ |
| InChIKey | RIQLFOOJGBPBOT-MDZDMXLPSA-N |
| XLogP | 2.90 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|