C16H29N5O3 — CID 3662259
1-butyl-5-[N-[2-(diethylamino)ethylamino]-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3662259) has the molecular formula C16H29N5O3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-butyl-5-[N-[2-(diethylamino)ethylamino]-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-[N-[2-(diethylamino)ethylamino]-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3662259 |
| Molecular Formula | C16H29N5O3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1-butyl-5-[N-[2-(diethylamino)ethylamino]-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(C(C)=NNCCN(CC)CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H29N5O3/c1-5-8-10-21-15(23)13(14(22)18-16(21)24)12(4)19-17-9-11-20(6-2)7-3/h17,23H,5-11H2,1-4H3,(H,18,22,24) |
| InChIKey | XAPZTLWCIAKRGX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|