C17H29N3O3 — CID 3251903
1-butyl-5-(C-ethyl-N-hexylcarbonimidoyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 3251903) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-butyl-5-(C-ethyl-N-hexylcarbonimidoyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-(C-ethyl-N-hexylcarbonimidoyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3251903 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-butyl-5-(C-ethyl-N-hexylcarbonimidoyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCCC/N=C(\CC)c1c(O)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N3O3/c1-4-7-9-10-11-18-13(6-3)14-15(21)19-17(23)20(16(14)22)12-8-5-2/h22H,4-12H2,1-3H3,(H,19,21,23)/b18-13+ |
| InChIKey | HAMBDJQIBDNKBB-QGOAFFKASA-N |
| XLogP | 2.82 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|