C10H16N4O4 — CID 172765496
1-hexyl-1,3,5-triazinane-2,4,6-trione;isocyanic acid (PubChem CID 172765496) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-hexyl-1,3,5-triazinane-2,4,6-trione;isocyanic acid.
| Compound Name | 1-hexyl-1,3,5-triazinane-2,4,6-trione;isocyanic acid |
|---|---|
| PubChem CID | 172765496 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-hexyl-1,3,5-triazinane-2,4,6-trione;isocyanic acid |
| SMILES | CCCCCCn1c(=O)[nH]c(=O)[nH]c1=O.N=C=O |
| InChI | InChI=1S/C9H15N3O3.CHNO/c1-2-3-4-5-6-12-8(14)10-7(13)11-9(12)15;2-1-3/h2-6H2,1H3,(H2,10,11,13,14,15);2H |
| InChIKey | MGHCHSDXXGMFOA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|