C13H23N3O4 — CID 142290124
1-(nonoxymethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 142290124) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-(nonoxymethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(nonoxymethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142290124 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(nonoxymethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCCCCCOCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H23N3O4/c1-2-3-4-5-6-7-8-9-20-10-16-12(18)14-11(17)15-13(16)19/h2-10H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | DDMZPQFJDRFUTG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|