C10H16N4O3 — CID 10331856
6-amino-1-hexyl-5-nitrosopyrimidine-2,4-dione (PubChem CID 10331856) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-amino-1-hexyl-5-nitrosopyrimidine-2,4-dione.
| Compound Name | 6-amino-1-hexyl-5-nitrosopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10331856 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 6-amino-1-hexyl-5-nitrosopyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(N)c(N=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N4O3/c1-2-3-4-5-6-14-8(11)7(13-17)9(15)12-10(14)16/h2-6,11H2,1H3,(H,12,15,16) |
| InChIKey | RDPMRIRGKYIJNC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|