C9H15N3O3 — CID 82470977
5-amino-2-oxo-3-pentyl-1H-imidazole-4-carboxylic acid (PubChem CID 82470977) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-amino-2-oxo-3-pentyl-1H-imidazole-4-carboxylic acid.
| Compound Name | 5-amino-2-oxo-3-pentyl-1H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82470977 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 5-amino-2-oxo-3-pentyl-1H-imidazole-4-carboxylic acid |
| SMILES | CCCCCn1c(C(=O)O)c(N)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O3/c1-2-3-4-5-12-6(8(13)14)7(10)11-9(12)15/h2-5,10H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | WHFWHPKIJAEVBY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|