C12H14ClN3O3 — CID 68738502
6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridine-7-carboxylic acid (PubChem CID 68738502) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is 6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridine-7-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 68738502 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridine-7-carboxylic acid |
| SMILES | CCCCCn1c(=O)[nH]c2ncc(Cl)c(C(=O)O)c21 |
| InChI | InChI=1S/C12H14ClN3O3/c1-2-3-4-5-16-9-8(11(17)18)7(13)6-14-10(9)15-12(16)19/h6H,2-5H2,1H3,(H,17,18)(H,14,15,19) |
| InChIKey | NMQGJIQNTKQTAP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|