C20H25ClN4O — CID 67354673
6-chloro-7-[3-[(dimethylamino)methyl]phenyl]-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 67354673) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is 6-chloro-7-[3-[(dimethylamino)methyl]phenyl]-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-chloro-7-[3-[(dimethylamino)methyl]phenyl]-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67354673 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 6-chloro-7-[3-[(dimethylamino)methyl]phenyl]-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CCCCCn1c(=O)[nH]c2ncc(Cl)c(-c3cccc(CN(C)C)c3)c21 |
| InChI | InChI=1S/C20H25ClN4O/c1-4-5-6-10-25-18-17(16(21)12-22-19(18)23-20(25)26)15-9-7-8-14(11-15)13-24(2)3/h7-9,11-12H,4-6,10,13H2,1-3H3,(H,22,23,26) |
| InChIKey | YJPGMPSSFNYTTC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|