C15H21ClN4O2 — CID 68737544
N-[(6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridin-7-yl)methyl]-N-methylacetamide (PubChem CID 68737544) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[(6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridin-7-yl)methyl]-N-methylacetamide.
| Compound Name | N-[(6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridin-7-yl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 68737544 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[(6-chloro-2-oxo-1-pentyl-3H-imidazo[4,5-b]pyridin-7-yl)methyl]-N-methylacetamide |
| SMILES | CCCCCn1c(=O)[nH]c2ncc(Cl)c(CN(C)C(C)=O)c21 |
| InChI | InChI=1S/C15H21ClN4O2/c1-4-5-6-7-20-13-11(9-19(3)10(2)21)12(16)8-17-14(13)18-15(20)22/h8H,4-7,9H2,1-3H3,(H,17,18,22) |
| InChIKey | GJJHGTFZHOTEQF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|