C17H17Cl2N3O — CID 67355313
6-chloro-7-(4-chlorophenyl)-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 67355313) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 6-chloro-7-(4-chlorophenyl)-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-chloro-7-(4-chlorophenyl)-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67355313 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 6-chloro-7-(4-chlorophenyl)-1-pentyl-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CCCCCn1c(=O)[nH]c2ncc(Cl)c(-c3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C17H17Cl2N3O/c1-2-3-4-9-22-15-14(11-5-7-12(18)8-6-11)13(19)10-20-16(15)21-17(22)23/h5-8,10H,2-4,9H2,1H3,(H,20,21,23) |
| InChIKey | FAZCMLRAUCLBIY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|