About 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione
1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione (PubChem CID 11781054) has the molecular formula C15H16N4O2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 11781054 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c2nc(-c3ccccc3)[nH]c2c1=O |
| InChI | InChI=1S/C15H16N4O2/c1-2-3-9-19-14(20)11-13(18-15(19)21)17-12(16-11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,16,17)(H,18,21) |
| InChIKey | UGAWDWCYTZJBPQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione (CID 11781054) is 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione is CCCCn1c(=O)[nH]c2nc(-c3ccccc3)[nH]c2c1=O.
What is the InChIKey of 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione?
The InChIKey is UGAWDWCYTZJBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O2/c1-2-3-9-19-14(20)11-13(18-15(19)21)17-12(16-11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,16,17)(H,18,21).
What are the key properties of 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione?
1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione has a molecular weight of 284.32 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 11781054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).