C15H16N4O2 — CID 11781054
1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione (PubChem CID 11781054) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione.
| Compound Name | 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 11781054 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-butyl-8-phenyl-3,7-dihydropurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c2nc(-c3ccccc3)[nH]c2c1=O |
| InChI | InChI=1S/C15H16N4O2/c1-2-3-9-19-14(20)11-13(18-15(19)21)17-12(16-11)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,16,17)(H,18,21) |
| InChIKey | UGAWDWCYTZJBPQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |