C23H28N6O2 — CID 11524593
8-(1-benzylpyrazol-4-yl)-1,3-dibutyl-7H-purine-2,6-dione (PubChem CID 11524593) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 8-(1-benzylpyrazol-4-yl)-1,3-dibutyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-benzylpyrazol-4-yl)-1,3-dibutyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11524593 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 8-(1-benzylpyrazol-4-yl)-1,3-dibutyl-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2[nH]c(-c3cnn(Cc4ccccc4)c3)nc2n(CCCC)c1=O |
| InChI | InChI=1S/C23H28N6O2/c1-3-5-12-28-21-19(22(30)29(23(28)31)13-6-4-2)25-20(26-21)18-14-24-27(16-18)15-17-10-8-7-9-11-17/h7-11,14,16H,3-6,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | KTFZMFONLBKWAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |