C23H27ClN6O2 — CID 59395887
1-[3-(1-benzylpyrazol-4-yl)propyl]-8-chloro-3-pentyl-7H-purine-2,6-dione (PubChem CID 59395887) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is 1-[3-(1-benzylpyrazol-4-yl)propyl]-8-chloro-3-pentyl-7H-purine-2,6-dione.
| Compound Name | 1-[3-(1-benzylpyrazol-4-yl)propyl]-8-chloro-3-pentyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395887 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[3-(1-benzylpyrazol-4-yl)propyl]-8-chloro-3-pentyl-7H-purine-2,6-dione |
| SMILES | CCCCCn1c(=O)n(CCCc2cnn(Cc3ccccc3)c2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H27ClN6O2/c1-2-3-7-12-29-20-19(26-22(24)27-20)21(31)30(23(29)32)13-8-11-18-14-25-28(16-18)15-17-9-5-4-6-10-17/h4-6,9-10,14,16H,2-3,7-8,11-13,15H2,1H3,(H,26,27) |
| InChIKey | IPDPKCYSPDTDIZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|