C22H27ClN4O4 — CID 59405405
benzyl 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanoate (PubChem CID 59405405) has the molecular formula C22H27ClN4O4 and a molecular weight of 446.94 g/mol. Its IUPAC name is benzyl 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanoate.
| Compound Name | benzyl 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanoate |
|---|---|
| PubChem CID | 59405405 |
| Molecular Formula | C22H27ClN4O4 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | benzyl 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanoate |
| SMILES | CCCCCn1c(=O)n(CCCCC(=O)OCc2ccccc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C22H27ClN4O4/c1-2-3-8-13-26-19-18(24-21(23)25-19)20(29)27(22(26)30)14-9-7-12-17(28)31-15-16-10-5-4-6-11-16/h4-6,10-11H,2-3,7-9,12-15H2,1H3,(H,24,25) |
| InChIKey | AFVJEYURYPUESO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|