C20H24ClN5O4 — CID 59405128
2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethyl N-benzylcarbamate (PubChem CID 59405128) has the molecular formula C20H24ClN5O4 and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethyl N-benzylcarbamate.
| Compound Name | 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethyl N-benzylcarbamate |
|---|---|
| PubChem CID | 59405128 |
| Molecular Formula | C20H24ClN5O4 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethyl N-benzylcarbamate |
| SMILES | CCCCCn1c(=O)n(CCOC(=O)NCc2ccccc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C20H24ClN5O4/c1-2-3-7-10-25-16-15(23-18(21)24-16)17(27)26(20(25)29)11-12-30-19(28)22-13-14-8-5-4-6-9-14/h4-6,8-9H,2-3,7,10-13H2,1H3,(H,22,28)(H,23,24) |
| InChIKey | XSKCAQLKKNRYLV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|