C26H28ClN5O3 — CID 59405193
N-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]-4-phenylbenzamide (PubChem CID 59405193) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is N-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]-4-phenylbenzamide.
| Compound Name | N-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 59405193 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]-4-phenylbenzamide |
| SMILES | CCCCCn1c(=O)n(CCCNC(=O)c2ccc(-c3ccccc3)cc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C26H28ClN5O3/c1-2-3-7-16-31-22-21(29-25(27)30-22)24(34)32(26(31)35)17-8-15-28-23(33)20-13-11-19(12-14-20)18-9-5-4-6-10-18/h4-6,9-14H,2-3,7-8,15-17H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | INLARTBSSKEJIY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|