C21H28ClN5O2 — CID 143405389
8-chloro-1-[4-[4-(methylamino)phenyl]butyl]-3-pentyl-7H-purine-2,6-dione (PubChem CID 143405389) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is 8-chloro-1-[4-[4-(methylamino)phenyl]butyl]-3-pentyl-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1-[4-[4-(methylamino)phenyl]butyl]-3-pentyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 143405389 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 8-chloro-1-[4-[4-(methylamino)phenyl]butyl]-3-pentyl-7H-purine-2,6-dione |
| SMILES | CCCCCn1c(=O)n(CCCCc2ccc(NC)cc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C21H28ClN5O2/c1-3-4-6-13-26-18-17(24-20(22)25-18)19(28)27(21(26)29)14-7-5-8-15-9-11-16(23-2)12-10-15/h9-12,23H,3-8,13-14H2,1-2H3,(H,24,25) |
| InChIKey | UFHLGSDDAYYTEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|