C22H24Cl2N6O3 — CID 59395525
8-chloro-1-[3-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]propyl]-3-pentyl-7H-purine-2,6-dione (PubChem CID 59395525) has the molecular formula C22H24Cl2N6O3 and a molecular weight of 491.38 g/mol. Its IUPAC name is 8-chloro-1-[3-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]propyl]-3-pentyl-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1-[3-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]propyl]-3-pentyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395525 |
| Molecular Formula | C22H24Cl2N6O3 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 8-chloro-1-[3-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]propyl]-3-pentyl-7H-purine-2,6-dione |
| SMILES | CCCCCn1c(=O)n(CCCc2nc(Cc3ccc(Cl)cc3)no2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C22H24Cl2N6O3/c1-2-3-4-11-29-19-18(26-21(24)27-19)20(31)30(22(29)32)12-5-6-17-25-16(28-33-17)13-14-7-9-15(23)10-8-14/h7-10H,2-6,11-13H2,1H3,(H,26,27) |
| InChIKey | LOCZHEAODWYEOS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|