C22H28ClN5O4 — CID 59405278
3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-[(4-methylphenyl)methyl]carbamate (PubChem CID 59405278) has the molecular formula C22H28ClN5O4 and a molecular weight of 461.95 g/mol. Its IUPAC name is 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-[(4-methylphenyl)methyl]carbamate.
| Compound Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-[(4-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 59405278 |
| Molecular Formula | C22H28ClN5O4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl N-[(4-methylphenyl)methyl]carbamate |
| SMILES | CCCCCn1c(=O)n(CCCOC(=O)NCc2ccc(C)cc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C22H28ClN5O4/c1-3-4-5-11-27-18-17(25-20(23)26-18)19(29)28(22(27)31)12-6-13-32-21(30)24-14-16-9-7-15(2)8-10-16/h7-10H,3-6,11-14H2,1-2H3,(H,24,30)(H,25,26) |
| InChIKey | JXQSZVNGEFTWEQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|