C23H27ClF3N5O3 — CID 59405108
5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]pentanamide (PubChem CID 59405108) has the molecular formula C23H27ClF3N5O3 and a molecular weight of 513.95 g/mol. Its IUPAC name is 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]pentanamide.
| Compound Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 59405108 |
| Molecular Formula | C23H27ClF3N5O3 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]pentanamide |
| SMILES | CCCCCn1c(=O)n(CCCCC(=O)NCc2ccc(C(F)(F)F)cc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H27ClF3N5O3/c1-2-3-5-12-31-19-18(29-21(24)30-19)20(34)32(22(31)35)13-6-4-7-17(33)28-14-15-8-10-16(11-9-15)23(25,26)27/h8-11H,2-7,12-14H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | CMLSTDORCOXOSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|