C13H18ClN5O3 — CID 143405412
3-butyl-8-chloro-1-(4-nitrosobutyl)-7H-purine-2,6-dione (PubChem CID 143405412) has the molecular formula C13H18ClN5O3 and a molecular weight of 327.77 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-(4-nitrosobutyl)-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-(4-nitrosobutyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 143405412 |
| Molecular Formula | C13H18ClN5O3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-butyl-8-chloro-1-(4-nitrosobutyl)-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCN=O)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C13H18ClN5O3/c1-2-3-7-18-10-9(16-12(14)17-10)11(20)19(13(18)21)8-5-4-6-15-22/h2-8H2,1H3,(H,16,17) |
| InChIKey | QMQDIWOVACPYJY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|