C20H21Cl3N8O2 — CID 59395814
3-butyl-8-chloro-1-[4-[5-(3,5-dichlorophenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione (PubChem CID 59395814) has the molecular formula C20H21Cl3N8O2 and a molecular weight of 511.80 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-[4-[5-(3,5-dichlorophenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-[4-[5-(3,5-dichlorophenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395814 |
| Molecular Formula | C20H21Cl3N8O2 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 3-butyl-8-chloro-1-[4-[5-(3,5-dichlorophenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCn2nnc(-c3cc(Cl)cc(Cl)c3)n2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C20H21Cl3N8O2/c1-2-3-6-29-17-15(24-19(23)25-17)18(32)30(20(29)33)7-4-5-8-31-27-16(26-28-31)12-9-13(21)11-14(22)10-12/h9-11H,2-8H2,1H3,(H,24,25) |
| InChIKey | LTMYSEOJPXUNTL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|