C20H23ClN8O2 — CID 59395645
3-butyl-8-chloro-1-[4-(5-phenyltetrazol-1-yl)butyl]-7H-purine-2,6-dione (PubChem CID 59395645) has the molecular formula C20H23ClN8O2 and a molecular weight of 442.91 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-[4-(5-phenyltetrazol-1-yl)butyl]-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-[4-(5-phenyltetrazol-1-yl)butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395645 |
| Molecular Formula | C20H23ClN8O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-butyl-8-chloro-1-[4-(5-phenyltetrazol-1-yl)butyl]-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCn2nnnc2-c2ccccc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C20H23ClN8O2/c1-2-3-11-27-17-15(22-19(21)23-17)18(30)28(20(27)31)12-7-8-13-29-16(24-25-26-29)14-9-5-4-6-10-14/h4-6,9-10H,2-3,7-8,11-13H2,1H3,(H,22,23) |
| InChIKey | HAMHBYKVSMCGLT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|