C21H25ClN8O2 — CID 59395585
3-butyl-8-chloro-1-[4-[5-(3-methylphenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione (PubChem CID 59395585) has the molecular formula C21H25ClN8O2 and a molecular weight of 456.94 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-[4-[5-(3-methylphenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-[4-[5-(3-methylphenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395585 |
| Molecular Formula | C21H25ClN8O2 |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-butyl-8-chloro-1-[4-[5-(3-methylphenyl)tetrazol-2-yl]butyl]-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCn2nnc(-c3cccc(C)c3)n2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C21H25ClN8O2/c1-3-4-10-28-18-16(23-20(22)24-18)19(31)29(21(28)32)11-5-6-12-30-26-17(25-27-30)15-9-7-8-14(2)13-15/h7-9,13H,3-6,10-12H2,1-2H3,(H,23,24) |
| InChIKey | KTHWEXCZYPQXDC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|