C23H22ClN7O4 — CID 59405245
2-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]benzo[f]benzotriazole-4,9-dione (PubChem CID 59405245) has the molecular formula C23H22ClN7O4 and a molecular weight of 495.93 g/mol. Its IUPAC name is 2-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]benzo[f]benzotriazole-4,9-dione.
| Compound Name | 2-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]benzo[f]benzotriazole-4,9-dione |
|---|---|
| PubChem CID | 59405245 |
| Molecular Formula | C23H22ClN7O4 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl]benzo[f]benzotriazole-4,9-dione |
| SMILES | CCCCCn1c(=O)n(CCCn2nc3c(n2)C(=O)c2ccccc2C3=O)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H22ClN7O4/c1-2-3-6-10-29-20-17(25-22(24)26-20)21(34)30(23(29)35)11-7-12-31-27-15-16(28-31)19(33)14-9-5-4-8-13(14)18(15)32/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,25,26) |
| InChIKey | NOUBFRJIRPLYDH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 137.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|