C13H19IN4O2 — CID 11406633
1,3-dibutyl-8-iodo-7H-purine-2,6-dione (PubChem CID 11406633) has the molecular formula C13H19IN4O2 and a molecular weight of 390.23 g/mol. Its IUPAC name is 1,3-dibutyl-8-iodo-7H-purine-2,6-dione.
| Compound Name | 1,3-dibutyl-8-iodo-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11406633 |
| Molecular Formula | C13H19IN4O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1,3-dibutyl-8-iodo-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2[nH]c(I)nc2n(CCCC)c1=O |
| InChI | InChI=1S/C13H19IN4O2/c1-3-5-7-17-10-9(15-12(14)16-10)11(19)18(13(17)20)8-6-4-2/h3-8H2,1-2H3,(H,15,16) |
| InChIKey | NVXIYTQSSBFAGO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|