C12H16N4O4 — CID 57052107
2,6-dioxo-1,3-dipropyl-7H-purine-8-carboxylic acid (PubChem CID 57052107) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,6-dioxo-1,3-dipropyl-7H-purine-8-carboxylic acid.
| Compound Name | 2,6-dioxo-1,3-dipropyl-7H-purine-8-carboxylic acid |
|---|---|
| PubChem CID | 57052107 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2,6-dioxo-1,3-dipropyl-7H-purine-8-carboxylic acid |
| SMILES | CCCn1c(=O)c2[nH]c(C(=O)O)nc2n(CCC)c1=O |
| InChI | InChI=1S/C12H16N4O4/c1-3-5-15-9-7(13-8(14-9)11(18)19)10(17)16(6-4-2)12(15)20/h3-6H2,1-2H3,(H,13,14)(H,18,19) |
| InChIKey | WNXXRZYNWGBCGG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |