About N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide
N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide (PubChem CID 59405518) has the molecular formula C23H30ClN5O5
and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide |
| PubChem CID | 59405518 |
| Molecular Formula | C23H30ClN5O5 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide |
| SMILES | CCCCCn1c(=O)n(CCCCOc2ccc(NC(C)=O)cc2OC)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H30ClN5O5/c1-4-5-6-11-28-20-19(26-22(24)27-20)21(31)29(23(28)32)12-7-8-13-34-17-10-9-16(25-15(2)30)14-18(17)33-3/h9-10,14H,4-8,11-13H2,1-3H3,(H,25,30)(H,26,27) |
| InChIKey | MJJQVTVKQBXVPT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide?
The IUPAC name of N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide (CID 59405518) is N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide.
What is the SMILES notation for N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide?
The canonical SMILES for N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide is CCCCCn1c(=O)n(CCCCOc2ccc(NC(C)=O)cc2OC)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide?
The InChIKey is MJJQVTVKQBXVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30ClN5O5/c1-4-5-6-11-28-20-19(26-22(24)27-20)21(31)29(23(28)32)12-7-8-13-34-17-10-9-16(25-15(2)30)14-18(17)33-3/h9-10,14H,4-8,11-13H2,1-3H3,(H,25,30)(H,26,27).
What are the key properties of N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide?
N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide has a molecular weight of 491.98 g/mol, XLogP of 3.56, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide is sourced from PubChem (CID 59405518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).