C23H30ClN5O5 — CID 59405518
N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide (PubChem CID 59405518) has the molecular formula C23H30ClN5O5 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide.
| Compound Name | N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 59405518 |
| Molecular Formula | C23H30ClN5O5 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[4-[4-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)butoxy]-3-methoxyphenyl]acetamide |
| SMILES | CCCCCn1c(=O)n(CCCCOc2ccc(NC(C)=O)cc2OC)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H30ClN5O5/c1-4-5-6-11-28-20-19(26-22(24)27-20)21(31)29(23(28)32)12-7-8-13-34-17-10-9-16(25-15(2)30)14-18(17)33-3/h9-10,14H,4-8,11-13H2,1-3H3,(H,25,30)(H,26,27) |
| InChIKey | MJJQVTVKQBXVPT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|