C22H28ClN5O3 — CID 91355722
5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-phenylhexanamide (PubChem CID 91355722) has the molecular formula C22H28ClN5O3 and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-phenylhexanamide.
| Compound Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-phenylhexanamide |
|---|---|
| PubChem CID | 91355722 |
| Molecular Formula | C22H28ClN5O3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)-N-phenylhexanamide |
| SMILES | CCCCCn1c(=O)n(C(C)CCCC(=O)Nc2ccccc2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C22H28ClN5O3/c1-3-4-8-14-27-19-18(25-21(23)26-19)20(30)28(22(27)31)15(2)10-9-13-17(29)24-16-11-6-5-7-12-16/h5-7,11-12,15H,3-4,8-10,13-14H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | CUPDVBLHEBKNAN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|