C17H16N6O2 — CID 11493754
8-(1-benzylpyrazol-4-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 11493754) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 8-(1-benzylpyrazol-4-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-benzylpyrazol-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11493754 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 8-(1-benzylpyrazol-4-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cnn(Cc4ccccc4)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C17H16N6O2/c1-21-15-13(16(24)22(2)17(21)25)19-14(20-15)12-8-18-23(10-12)9-11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3,(H,19,20) |
| InChIKey | MCZMFSIUZOSVRA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |