C23H23N5O4 — CID 1259059
2-[4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)phenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 1259059) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)phenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)phenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 1259059 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)phenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccc(OCC(=O)NCCc4ccccc4)cc3)nc2n(C)c1=O |
| InChI | InChI=1S/C23H23N5O4/c1-27-21-19(22(30)28(2)23(27)31)25-20(26-21)16-8-10-17(11-9-16)32-14-18(29)24-13-12-15-6-4-3-5-7-15/h3-11H,12-14H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | LILCYRREISQMAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |