C28H32BrN7O4S — CID 14485006
N-[2-[(4-bromophenyl)carbamothioylamino]ethyl]-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide (PubChem CID 14485006) has the molecular formula C28H32BrN7O4S and a molecular weight of 642.58 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamothioylamino]ethyl]-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamothioylamino]ethyl]-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 14485006 |
| Molecular Formula | C28H32BrN7O4S |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamothioylamino]ethyl]-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(OCC(=O)NCCNC(=S)Nc4ccc(Br)cc4)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C28H32BrN7O4S/c1-3-15-35-25-23(26(38)36(16-4-2)28(35)39)33-24(34-25)18-5-11-21(12-6-18)40-17-22(37)30-13-14-31-27(41)32-20-9-7-19(29)8-10-20/h5-12H,3-4,13-17H2,1-2H3,(H,30,37)(H,33,34)(H2,31,32,41) |
| InChIKey | YTCORRDZXGSXAP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|