C30H38N8O5 — CID 100985617
(2S)-2-amino-3-(4-aminophenyl)-N-[2-[[2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetyl]amino]ethyl]propanamide (PubChem CID 100985617) has the molecular formula C30H38N8O5 and a molecular weight of 590.69 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-aminophenyl)-N-[2-[[2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetyl]amino]ethyl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-aminophenyl)-N-[2-[[2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 100985617 |
| Molecular Formula | C30H38N8O5 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | (2S)-2-amino-3-(4-aminophenyl)-N-[2-[[2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetyl]amino]ethyl]propanamide |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(OCC(=O)NCCNC(=O)[C@@H](N)Cc4ccc(N)cc4)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C30H38N8O5/c1-3-15-37-27-25(29(41)38(16-4-2)30(37)42)35-26(36-27)20-7-11-22(12-8-20)43-18-24(39)33-13-14-34-28(40)23(32)17-19-5-9-21(31)10-6-19/h5-12,23H,3-4,13-18,31-32H2,1-2H3,(H,33,39)(H,34,40)(H,35,36)/t23-/m0/s1 |
| InChIKey | DGZOTFJHGDFRHK-QHCPKHFHSA-N |
| XLogP | 1.14 |
| TPSA | 192.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|