C20H26N6O4 — CID 25069791
[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenyl] N-(2-aminoethyl)carbamate (PubChem CID 25069791) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is [4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenyl] N-(2-aminoethyl)carbamate.
| Compound Name | [4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenyl] N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 25069791 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenyl] N-(2-aminoethyl)carbamate |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(OC(=O)NCCN)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C20H26N6O4/c1-3-11-25-17-15(18(27)26(12-4-2)20(25)29)23-16(24-17)13-5-7-14(8-6-13)30-19(28)22-10-9-21/h5-8H,3-4,9-12,21H2,1-2H3,(H,22,28)(H,23,24) |
| InChIKey | NFGNUBJZCNWODQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |