C17H22N6O2 — CID 67054391
8-[6-(methylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 67054391) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-[6-(methylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[6-(methylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67054391 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 8-[6-(methylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(NC)nc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H22N6O2/c1-4-8-22-15-13(16(24)23(9-5-2)17(22)25)20-14(21-15)11-6-7-12(18-3)19-10-11/h6-7,10H,4-5,8-9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | UZVULRPRIUSGOU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |