C20H28N6O4 — CID 67054373
8-[6-(2,2-dimethoxyethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 67054373) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 8-[6-(2,2-dimethoxyethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[6-(2,2-dimethoxyethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67054373 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 8-[6-(2,2-dimethoxyethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(NCC(OC)OC)nc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C20H28N6O4/c1-5-9-25-18-16(19(27)26(10-6-2)20(25)28)23-17(24-18)13-7-8-14(21-11-13)22-12-15(29-3)30-4/h7-8,11,15H,5-6,9-10,12H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | YEYAJHKHEQLJSU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|