C29H28ClN7O4 — CID 87251407
8-[6-[[2-(6-chloro-3-pyridinyl)-2-oxoethyl]amino]-3-pyridinyl]-3-[1-(4-methoxyphenyl)ethyl]-1-propyl-7H-purine-2,6-dione (PubChem CID 87251407) has the molecular formula C29H28ClN7O4 and a molecular weight of 574.04 g/mol. Its IUPAC name is 8-[6-[[2-(6-chloro-3-pyridinyl)-2-oxoethyl]amino]-3-pyridinyl]-3-[1-(4-methoxyphenyl)ethyl]-1-propyl-7H-purine-2,6-dione.
| Compound Name | 8-[6-[[2-(6-chloro-3-pyridinyl)-2-oxoethyl]amino]-3-pyridinyl]-3-[1-(4-methoxyphenyl)ethyl]-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 87251407 |
| Molecular Formula | C29H28ClN7O4 |
| Molecular Weight | 574.04 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 8-[6-[[2-(6-chloro-3-pyridinyl)-2-oxoethyl]amino]-3-pyridinyl]-3-[1-(4-methoxyphenyl)ethyl]-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(NCC(=O)c4ccc(Cl)nc4)nc3)nc2n(C(C)c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C29H28ClN7O4/c1-4-13-36-28(39)25-27(37(29(36)40)17(2)18-5-9-21(41-3)10-6-18)35-26(34-25)20-8-12-24(32-15-20)33-16-22(38)19-7-11-23(30)31-14-19/h5-12,14-15,17H,4,13,16H2,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | BMSWYTZITHFINJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|